C25H22F3N7O — CID 68169546
N-[4-[2-(dimethylamino)ethoxy]phenyl]-7-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzo[c][2,6]naphthyridin-5-amine (PubChem CID 68169546) has the molecular formula C25H22F3N7O and a molecular weight of 493.50 g/mol. Its IUPAC name is N-[4-[2-(dimethylamino)ethoxy]phenyl]-7-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzo[c][2,6]naphthyridin-5-amine.
| Compound Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-7-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzo[c][2,6]naphthyridin-5-amine |
|---|---|
| PubChem CID | 68169546 |
| Molecular Formula | C25H22F3N7O |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[4-[2-(dimethylamino)ethoxy]phenyl]-7-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]benzo[c][2,6]naphthyridin-5-amine |
| SMILES | CN(C)CCOC1=CC=C(C=C1)NC2=C3C=CN=CC3=C4C=CC=C(C4=N2)C5=NNC(=N5)C(F)(F)F |
| InChI | InChI=1S/C25H22F3N7O/c1-35(2)12-13-36-16-8-6-15(7-9-16)30-22-18-10-11-29-14-20(18)17-4-3-5-19(21(17)31-22)23-32-24(34-33-23)25(26,27)28/h3-11,14H,12-13H2,1-2H3,(H,30,31)(H,32,33,34) |
| InChIKey | WJHXBJTVBKMUSP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | 706 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|