About 4-ethenoxyaniline
4-ethenoxyaniline (PubChem CID 681955) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-ethenoxyaniline.
Molecular Properties
| Compound Name | 4-ethenoxyaniline |
| PubChem CID | 681955 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 4-ethenoxyaniline |
| SMILES | C=COc1ccc(N)cc1 |
| InChI | InChI=1S/C8H9NO/c1-2-10-8-5-3-7(9)4-6-8/h2-6H,1,9H2 |
| InChIKey | QCTFMVJQPRXEII-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxyaniline?
The IUPAC name of 4-ethenoxyaniline (CID 681955) is 4-ethenoxyaniline.
What is the SMILES notation for 4-ethenoxyaniline?
The canonical SMILES for 4-ethenoxyaniline is C=COc1ccc(N)cc1.
What is the InChIKey of 4-ethenoxyaniline?
The InChIKey is QCTFMVJQPRXEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c1-2-10-8-5-3-7(9)4-6-8/h2-6H,1,9H2.
What are the key properties of 4-ethenoxyaniline?
4-ethenoxyaniline has a molecular weight of 135.17 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxyaniline is sourced from PubChem (CID 681955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).