C19H10N4O2 — CID 682011
3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,15,17,19(23),20-nonaene-8,14-dione (PubChem CID 682011) has the molecular formula C19H10N4O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,15,17,19(23),20-nonaene-8,14-dione.
| Compound Name | 3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,15,17,19(23),20-nonaene-8,14-dione |
|---|---|
| PubChem CID | 682011 |
| Molecular Formula | C19H10N4O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3,7,9,13-tetrazahexacyclo[13.7.1.02,13.04,12.06,10.019,23]tricosa-1(22),2,4(12),5,10,15,17,19(23),20-nonaene-8,14-dione |
| SMILES | O=c1[nH]c2cc3nc4c5cccc6cccc(c(=O)n4c3cc2[nH]1)c65 |
| InChI | InChI=1S/C19H10N4O2/c24-18-11-6-2-4-9-3-1-5-10(16(9)11)17-20-14-7-12-13(22-19(25)21-12)8-15(14)23(17)18/h1-8H,(H2,21,22,25) |
| InChIKey | FRNXZNBGSBEKHW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |