C18H12BrFN2O4S — CID 6821678
5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 6821678) has the molecular formula C18H12BrFN2O4S and a molecular weight of 451.27 g/mol. Its IUPAC name is 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 6821678 |
| Molecular Formula | C18H12BrFN2O4S |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(3-fluorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)NC(=S)N(c3cccc(F)c3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C18H12BrFN2O4S/c1-26-15-6-9(13(19)8-14(15)23)5-12-16(24)21-18(27)22(17(12)25)11-4-2-3-10(20)7-11/h2-8,23H,1H3,(H,21,24,27) |
| InChIKey | HGRZUIRABVPPKL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|