C10H8N2O3S — CID 682274
(3aS,8bR)-3a,8b-dihydroxy-2-sulfanylidene-1,3-dihydroindeno[1,2-d]imidazol-4-one (PubChem CID 682274) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is (3aS,8bR)-3a,8b-dihydroxy-2-sulfanylidene-1,3-dihydroindeno[1,2-d]imidazol-4-one.
| Compound Name | (3aS,8bR)-3a,8b-dihydroxy-2-sulfanylidene-1,3-dihydroindeno[1,2-d]imidazol-4-one |
|---|---|
| PubChem CID | 682274 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (3aS,8bR)-3a,8b-dihydroxy-2-sulfanylidene-1,3-dihydroindeno[1,2-d]imidazol-4-one |
| SMILES | O=C1c2ccccc2[C@]2(O)NC(=S)N[C@@]12O |
| InChI | InChI=1S/C10H8N2O3S/c13-7-5-3-1-2-4-6(5)9(14)10(7,15)12-8(16)11-9/h1-4,14-15H,(H2,11,12,16)/t9-,10-/m1/s1 |
| InChIKey | ANUGYOJFCCLRRR-NXEZZACHSA-N |
| XLogP | -0.81 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|