About 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione
1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 682328) has the molecular formula C11H7Cl2FN2O2
and a molecular weight of 289.09 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 682328 |
| Molecular Formula | C11H7Cl2FN2O2 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2c(Cl)cccc2Cl)cc1F |
| InChI | InChI=1S/C11H7Cl2FN2O2/c12-7-2-1-3-8(13)6(7)4-16-5-9(14)10(17)15-11(16)18/h1-3,5H,4H2,(H,15,17,18) |
| InChIKey | HCLAQGSQXWDQMD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione (CID 682328) is 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione is O=c1[nH]c(=O)n(Cc2c(Cl)cccc2Cl)cc1F.
What is the InChIKey of 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is HCLAQGSQXWDQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2FN2O2/c12-7-2-1-3-8(13)6(7)4-16-5-9(14)10(17)15-11(16)18/h1-3,5H,4H2,(H,15,17,18).
What are the key properties of 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione?
1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 289.09 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dichlorophenyl)methyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 682328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).