C8H13N5 — CID 6825223
N,N-dimethyl-N'-[(6-methylpyridazin-3-yl)amino]methanimidamide (PubChem CID 6825223) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(6-methylpyridazin-3-yl)amino]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[(6-methylpyridazin-3-yl)amino]methanimidamide |
|---|---|
| PubChem CID | 6825223 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | N,N-dimethyl-N'-[(6-methylpyridazin-3-yl)amino]methanimidamide |
| SMILES | Cc1ccc(NN=CN(C)C)nn1 |
| InChI | InChI=1S/C8H13N5/c1-7-4-5-8(12-10-7)11-9-6-13(2)3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | HRPZTQPOHSFHAA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|