About methyl 2-(methylamino)benzoate
methyl 2-(methylamino)benzoate (PubChem CID 6826) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 2-(methylamino)benzoate.
Molecular Properties
| Compound Name | methyl 2-(methylamino)benzoate |
| PubChem CID | 6826 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OC |
| InChI | InChI=1S/C9H11NO2/c1-10-8-6-4-3-5-7(8)9(11)12-2/h3-6,10H,1-2H3 |
| InChIKey | GVOWHGSUZUUUDR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(methylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(methylamino)benzoate?
The IUPAC name of methyl 2-(methylamino)benzoate (CID 6826) is methyl 2-(methylamino)benzoate.
What is the SMILES notation for methyl 2-(methylamino)benzoate?
The canonical SMILES for methyl 2-(methylamino)benzoate is CNc1ccccc1C(=O)OC.
What is the InChIKey of methyl 2-(methylamino)benzoate?
The InChIKey is GVOWHGSUZUUUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-10-8-6-4-3-5-7(8)9(11)12-2/h3-6,10H,1-2H3.
What are the key properties of methyl 2-(methylamino)benzoate?
methyl 2-(methylamino)benzoate has a molecular weight of 165.19 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methylamino)benzoate is sourced from PubChem (CID 6826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).