About bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt
bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt (PubChem CID 6827197) has the molecular formula C18H20CoN3O2-
and a molecular weight of 369.31 g/mol. Its IUPAC name is bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt.
Molecular Properties
| Compound Name | bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt |
| PubChem CID | 6827197 |
| Molecular Formula | C18H20CoN3O2- |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt |
| SMILES | O=C1C=CC=CC1=CNCC[N-]CCNC=C1C=CC=CC1=O.[Co] |
| InChI | InChI=1S/C18H20N3O2.Co/c22-17-7-3-1-5-15(17)13-20-11-9-19-10-12-21-14-16-6-2-4-8-18(16)23;/h1-8,13-14,20-21H,9-12H2;/q-1; |
| InChIKey | NPNRZQHWMGSGCG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt?
The IUPAC name of bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt (CID 6827197) is bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt.
What is the SMILES notation for bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt?
The canonical SMILES for bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt is O=C1C=CC=CC1=CNCC[N-]CCNC=C1C=CC=CC1=O.[Co].
What is the InChIKey of bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt?
The InChIKey is NPNRZQHWMGSGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N3O2.Co/c22-17-7-3-1-5-15(17)13-20-11-9-19-10-12-21-14-16-6-2-4-8-18(16)23;/h1-8,13-14,20-21H,9-12H2;/q-1;.
What are the key properties of bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt?
bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt has a molecular weight of 369.31 g/mol, XLogP of 1.69, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethyl]azanide;cobalt is sourced from PubChem (CID 6827197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).