About 1,3-diethyl-1,3-diphenylurea
1,3-diethyl-1,3-diphenylurea (PubChem CID 6828) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,3-diethyl-1,3-diphenylurea.
Molecular Properties
| Compound Name | 1,3-diethyl-1,3-diphenylurea |
| PubChem CID | 6828 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1,3-diethyl-1,3-diphenylurea |
| SMILES | CCN(C(=O)N(CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | PZIMIYVOZBTARW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diethyl-1,3-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-1,3-diphenylurea?
The IUPAC name of 1,3-diethyl-1,3-diphenylurea (CID 6828) is 1,3-diethyl-1,3-diphenylurea.
What is the SMILES notation for 1,3-diethyl-1,3-diphenylurea?
The canonical SMILES for 1,3-diethyl-1,3-diphenylurea is CCN(C(=O)N(CC)c1ccccc1)c1ccccc1.
What is the InChIKey of 1,3-diethyl-1,3-diphenylurea?
The InChIKey is PZIMIYVOZBTARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O/c1-3-18(15-11-7-5-8-12-15)17(20)19(4-2)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3.
What are the key properties of 1,3-diethyl-1,3-diphenylurea?
1,3-diethyl-1,3-diphenylurea has a molecular weight of 268.36 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-1,3-diphenylurea is sourced from PubChem (CID 6828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).