C12H12N5O+ — CID 682821
N-(furan-2-ylmethyl)-4,6,9-triaza-1-azoniatricyclo[5.3.1.04,11]undeca-1(11),5,7,9-tetraen-8-amine (PubChem CID 682821) has the molecular formula C12H12N5O+ and a molecular weight of 242.26 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,6,9-triaza-1-azoniatricyclo[5.3.1.04,11]undeca-1(11),5,7,9-tetraen-8-amine.
| Compound Name | N-(furan-2-ylmethyl)-4,6,9-triaza-1-azoniatricyclo[5.3.1.04,11]undeca-1(11),5,7,9-tetraen-8-amine |
|---|---|
| PubChem CID | 682821 |
| Molecular Formula | C12H12N5O+ |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,6,9-triaza-1-azoniatricyclo[5.3.1.04,11]undeca-1(11),5,7,9-tetraen-8-amine |
| SMILES | c1coc(CNc2nc[n+]3c4c2ncn4CC3)c1 |
| InChI | InChI=1S/C12H11N5O/c1-2-9(18-5-1)6-13-11-10-12-16(7-14-10)3-4-17(12)8-15-11/h1-2,5,7-8H,3-4,6H2/p+1 |
| InChIKey | CMRZPCFQWWXGHV-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|