About 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile
2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile (PubChem CID 682863) has the molecular formula C13H11N5O
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile |
| PubChem CID | 682863 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile |
| SMILES | Cc1[nH][nH]c(=O)c1[C@@H](c1ccncc1)C(C#N)C#N |
| InChI | InChI=1S/C13H11N5O/c1-8-11(13(19)18-17-8)12(10(6-14)7-15)9-2-4-16-5-3-9/h2-5,10,12H,1H3,(H2,17,18,19)/t12-/m0/s1 |
| InChIKey | BBQWABYEYZJCQD-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile?
The IUPAC name of 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile (CID 682863) is 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile.
What is the SMILES notation for 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile?
The canonical SMILES for 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile is Cc1[nH][nH]c(=O)c1[C@@H](c1ccncc1)C(C#N)C#N.
What is the InChIKey of 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile?
The InChIKey is BBQWABYEYZJCQD-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H11N5O/c1-8-11(13(19)18-17-8)12(10(6-14)7-15)9-2-4-16-5-3-9/h2-5,10,12H,1H3,(H2,17,18,19)/t12-/m0/s1.
What are the key properties of 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile?
2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile has a molecular weight of 253.26 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(R)-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)-pyridin-4-ylmethyl]propanedinitrile is sourced from PubChem (CID 682863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).