C15H17N6O+ — CID 6828905
N-[(4-propoxyphenyl)methylideneamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-6-amine (PubChem CID 6828905) has the molecular formula C15H17N6O+ and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[(4-propoxyphenyl)methylideneamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-6-amine.
| Compound Name | N-[(4-propoxyphenyl)methylideneamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-6-amine |
|---|---|
| PubChem CID | 6828905 |
| Molecular Formula | C15H17N6O+ |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(4-propoxyphenyl)methylideneamino]-2H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-6-amine |
| SMILES | CCCOc1ccc(C=NNc2ccc3n[nH]c[n+]3n2)cc1 |
| InChI | InChI=1S/C15H16N6O/c1-2-9-22-13-5-3-12(4-6-13)10-16-18-14-7-8-15-19-17-11-21(15)20-14/h3-8,10-11H,2,9H2,1H3,(H,18,20)/p+1 |
| InChIKey | ZFWXLQFOPIICAL-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|