About bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper
bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper (PubChem CID 6831350) has the molecular formula C22H28CuN4O2
and a molecular weight of 444.04 g/mol. Its IUPAC name is bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper.
Molecular Properties
| Compound Name | bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper |
| PubChem CID | 6831350 |
| Molecular Formula | C22H28CuN4O2 |
| Molecular Weight | 444.04 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper |
| SMILES | O=C1C=CC=CC1=CNCCN1CC1.O=C1C=CC=CC1=CNCCN1CC1.[Cu] |
| InChI | InChI=1S/2C11H14N2O.Cu/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,12H,5-8H2; |
| InChIKey | DLRCFJGHIYTUDQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.04 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The IUPAC name of bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper (CID 6831350) is bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper.
What is the SMILES notation for bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The canonical SMILES for bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper is O=C1C=CC=CC1=CNCCN1CC1.O=C1C=CC=CC1=CNCCN1CC1.[Cu].
What is the InChIKey of bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
The InChIKey is DLRCFJGHIYTUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H14N2O.Cu/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,12H,5-8H2;.
What are the key properties of bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper?
bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper has a molecular weight of 444.04 g/mol, XLogP of 0.94, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one);copper is sourced from PubChem (CID 6831350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).