About 2-benzyl-1H-pyridazine-3,6-dione
2-benzyl-1H-pyridazine-3,6-dione (PubChem CID 683539) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-benzyl-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-benzyl-1H-pyridazine-3,6-dione |
| PubChem CID | 683539 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-benzyl-1H-pyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)n(Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H10N2O2/c14-10-6-7-11(15)13(12-10)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,14) |
| InChIKey | JXOUKUODPDOMDY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-pyridazine-3,6-dione?
The IUPAC name of 2-benzyl-1H-pyridazine-3,6-dione (CID 683539) is 2-benzyl-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-benzyl-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-benzyl-1H-pyridazine-3,6-dione is O=c1ccc(=O)n(Cc2ccccc2)[nH]1.
What is the InChIKey of 2-benzyl-1H-pyridazine-3,6-dione?
The InChIKey is JXOUKUODPDOMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-10-6-7-11(15)13(12-10)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,14).
What are the key properties of 2-benzyl-1H-pyridazine-3,6-dione?
2-benzyl-1H-pyridazine-3,6-dione has a molecular weight of 202.21 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-pyridazine-3,6-dione is sourced from PubChem (CID 683539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).