About benzenecarbothioamide
benzenecarbothioamide (PubChem CID 683563) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is benzenecarbothioamide.
Molecular Properties
| Compound Name | benzenecarbothioamide |
| PubChem CID | 683563 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1 |
| InChI | InChI=1S/C7H7NS/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| InChIKey | QIOZLISABUUKJY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioamide?
The IUPAC name of benzenecarbothioamide (CID 683563) is benzenecarbothioamide.
What is the SMILES notation for benzenecarbothioamide?
The canonical SMILES for benzenecarbothioamide is NC(=S)c1ccccc1.
What is the InChIKey of benzenecarbothioamide?
The InChIKey is QIOZLISABUUKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9).
What are the key properties of benzenecarbothioamide?
benzenecarbothioamide has a molecular weight of 137.21 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioamide is sourced from PubChem (CID 683563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).