C10H14ClN7O — CID 683845
2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylacetamide (PubChem CID 683845) has the molecular formula C10H14ClN7O and a molecular weight of 283.72 g/mol. Its IUPAC name is 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylacetamide.
| Compound Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 683845 |
| Molecular Formula | C10H14ClN7O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C#N)c1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C10H14ClN7O/c1-16(2)7(19)5-18(6-12)10-14-8(11)13-9(15-10)17(3)4/h5H2,1-4H3 |
| InChIKey | LDMVNJYSLAZBKN-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|