About 2-(4-nitrophenyl)-1,3,4-oxadiazole
2-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 683939) has the molecular formula C8H5N3O3
and a molecular weight of 191.15 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)-1,3,4-oxadiazole |
| PubChem CID | 683939 |
| Molecular Formula | C8H5N3O3 |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C8H5N3O3/c12-11(13)7-3-1-6(2-4-7)8-10-9-5-14-8/h1-5H |
| InChIKey | FBQDNDLFVIKPRJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)-1,3,4-oxadiazole?
The IUPAC name of 2-(4-nitrophenyl)-1,3,4-oxadiazole (CID 683939) is 2-(4-nitrophenyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(4-nitrophenyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(4-nitrophenyl)-1,3,4-oxadiazole is O=[N+]([O-])c1ccc(-c2nnco2)cc1.
What is the InChIKey of 2-(4-nitrophenyl)-1,3,4-oxadiazole?
The InChIKey is FBQDNDLFVIKPRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O3/c12-11(13)7-3-1-6(2-4-7)8-10-9-5-14-8/h1-5H.
What are the key properties of 2-(4-nitrophenyl)-1,3,4-oxadiazole?
2-(4-nitrophenyl)-1,3,4-oxadiazole has a molecular weight of 191.15 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)-1,3,4-oxadiazole is sourced from PubChem (CID 683939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).