About 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline
5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline (PubChem CID 684139) has the molecular formula C11H12N4
and a molecular weight of 200.25 g/mol. Its IUPAC name is 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline.
Molecular Properties
| Compound Name | 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline |
| PubChem CID | 684139 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline |
| SMILES | CC1(C)Cc2ccccc2-c2nnnn21 |
| InChI | InChI=1S/C11H12N4/c1-11(2)7-8-5-3-4-6-9(8)10-12-13-14-15(10)11/h3-6H,7H2,1-2H3 |
| InChIKey | FQPUINDENAEALQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline?
The IUPAC name of 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline (CID 684139) is 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline.
What is the SMILES notation for 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline?
The canonical SMILES for 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline is CC1(C)Cc2ccccc2-c2nnnn21.
What is the InChIKey of 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline?
The InChIKey is FQPUINDENAEALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4/c1-11(2)7-8-5-3-4-6-9(8)10-12-13-14-15(10)11/h3-6H,7H2,1-2H3.
What are the key properties of 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline?
5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline has a molecular weight of 200.25 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6H-tetrazolo[5,1-a]isoquinoline is sourced from PubChem (CID 684139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).