C19H24O4 — CID 684214
9-acetyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 684214) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 9-acetyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-acetyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 684214 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 9-acetyl-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC(=O)C1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C19H24O4/c1-10(20)15-16-11(21)6-18(2,3)8-13(16)23-14-9-19(4,5)7-12(22)17(14)15/h15H,6-9H2,1-5H3 |
| InChIKey | DYYOMCQRFKLNAI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |