About zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one)
zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) (PubChem CID 6842643) has the molecular formula C22H28N4O2Zn+2
and a molecular weight of 445.88 g/mol. Its IUPAC name is zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one).
Molecular Properties
| Compound Name | zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) |
| PubChem CID | 6842643 |
| Molecular Formula | C22H28N4O2Zn+2 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) |
| SMILES | O=C1C=CC=CC1=CNCCN1CC1.O=C1C=CC=CC1=CNCCN1CC1.[Zn+2] |
| InChI | InChI=1S/2C11H14N2O.Zn/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,12H,5-8H2;/q;;+2 |
| InChIKey | ZDMWQKOEDWPDOC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one)?
The IUPAC name of zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) (CID 6842643) is zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one).
What is the SMILES notation for zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one)?
The canonical SMILES for zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) is O=C1C=CC=CC1=CNCCN1CC1.O=C1C=CC=CC1=CNCCN1CC1.[Zn+2].
What is the InChIKey of zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one)?
The InChIKey is ZDMWQKOEDWPDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H14N2O.Zn/c2*14-11-4-2-1-3-10(11)9-12-5-6-13-7-8-13;/h2*1-4,9,12H,5-8H2;/q;;+2.
What are the key properties of zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one)?
zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) has a molecular weight of 445.88 g/mol, XLogP of 0.94, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(6-[[2-(aziridin-1-yl)ethylamino]methylidene]cyclohexa-2,4-dien-1-one) is sourced from PubChem (CID 6842643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).