C25H21F3N4O4S — CID 6842990
7-(2-hydroxyethylcarbamoyl)-1-(2-methoxyphenyl)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]imidazo[1,2-a]pyridin-4-ium-2-thiolate (PubChem CID 6842990) has the molecular formula C25H21F3N4O4S and a molecular weight of 530.53 g/mol. Its IUPAC name is 7-(2-hydroxyethylcarbamoyl)-1-(2-methoxyphenyl)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]imidazo[1,2-a]pyridin-4-ium-2-thiolate.
| Compound Name | 7-(2-hydroxyethylcarbamoyl)-1-(2-methoxyphenyl)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]imidazo[1,2-a]pyridin-4-ium-2-thiolate |
|---|---|
| PubChem CID | 6842990 |
| Molecular Formula | C25H21F3N4O4S |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 7-(2-hydroxyethylcarbamoyl)-1-(2-methoxyphenyl)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]imidazo[1,2-a]pyridin-4-ium-2-thiolate |
| SMILES | COc1ccccc1-n1c([S-])c(C(=O)Nc2ccccc2C(F)(F)F)[n+]2ccc(C(=O)NCCO)cc12 |
| InChI | InChI=1S/C25H21F3N4O4S/c1-36-19-9-5-4-8-18(19)32-20-14-15(22(34)29-11-13-33)10-12-31(20)21(24(32)37)23(35)30-17-7-3-2-6-16(17)25(26,27)28/h2-10,12,14,33H,11,13H2,1H3,(H2-,29,30,34,35,37) |
| InChIKey | FFISASAJWWPCTK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|