About 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one
6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one (PubChem CID 684308) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one.
Molecular Properties
| Compound Name | 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one |
| PubChem CID | 684308 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one |
| SMILES | Cc1ccc2c(c1)c1c(n2C)C(=O)CCC1 |
| InChI | InChI=1S/C14H15NO/c1-9-6-7-12-11(8-9)10-4-3-5-13(16)14(10)15(12)2/h6-8H,3-5H2,1-2H3 |
| InChIKey | HUCYGURJOMKPRS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one?
The IUPAC name of 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one (CID 684308) is 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one.
What is the SMILES notation for 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one?
The canonical SMILES for 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one is Cc1ccc2c(c1)c1c(n2C)C(=O)CCC1.
What is the InChIKey of 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one?
The InChIKey is HUCYGURJOMKPRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-9-6-7-12-11(8-9)10-4-3-5-13(16)14(10)15(12)2/h6-8H,3-5H2,1-2H3.
What are the key properties of 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one?
6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one has a molecular weight of 213.28 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,9-dimethyl-3,4-dihydro-2H-carbazol-1-one is sourced from PubChem (CID 684308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).