C14H24N4S2 — CID 684421
4,4-dimethyl-6-[[(4R)-4,6,6-trimethyl-2-sulfanylidene-1,3-diazinan-4-yl]methyl]-1,3-dihydropyrimidine-2-thione (PubChem CID 684421) has the molecular formula C14H24N4S2 and a molecular weight of 312.51 g/mol. Its IUPAC name is 4,4-dimethyl-6-[[(4R)-4,6,6-trimethyl-2-sulfanylidene-1,3-diazinan-4-yl]methyl]-1,3-dihydropyrimidine-2-thione.
| Compound Name | 4,4-dimethyl-6-[[(4R)-4,6,6-trimethyl-2-sulfanylidene-1,3-diazinan-4-yl]methyl]-1,3-dihydropyrimidine-2-thione |
|---|---|
| PubChem CID | 684421 |
| Molecular Formula | C14H24N4S2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4,4-dimethyl-6-[[(4R)-4,6,6-trimethyl-2-sulfanylidene-1,3-diazinan-4-yl]methyl]-1,3-dihydropyrimidine-2-thione |
| SMILES | CC1(C)C=C(C[C@@]2(C)CC(C)(C)NC(=S)N2)NC(=S)N1 |
| InChI | InChI=1S/C14H24N4S2/c1-12(2)6-9(15-10(19)16-12)7-14(5)8-13(3,4)17-11(20)18-14/h6H,7-8H2,1-5H3,(H2,15,16,19)(H2,17,18,20)/t14-/m0/s1 |
| InChIKey | KWRNBXIOLNHDJM-AWEZNQCLSA-N |
| XLogP | 1.92 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|