2-hydroxyiminobutanoic acid

C4H7NO3 — CID 6844451

IUPAC2-hydroxyiminobutanoic acid
SMILESCCC(=NO)C(=O)O
InChIInChI=1S/C4H7NO3/c1-2-3(5-8)4(6)7/h8H,2H2,1H3,(H,6,7)
InChIKeyALSXSMFPNNAYPI-UHFFFAOYSA-N
MW117.10 g/mol
LogP0.31
Rot. Bonds2

About 2-hydroxyiminobutanoic acid

2-hydroxyiminobutanoic acid (PubChem CID 6844451) has the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. Its IUPAC name is 2-hydroxyiminobutanoic acid.

Molecular Properties

Compound Name2-hydroxyiminobutanoic acid
PubChem CID6844451
Molecular FormulaC4H7NO3
Molecular Weight117.10 g/mol
Exact Mass117.04
IUPAC Name2-hydroxyiminobutanoic acid
SMILESCCC(=NO)C(=O)O
InChIInChI=1S/C4H7NO3/c1-2-3(5-8)4(6)7/h8H,2H2,1H3,(H,6,7)
InChIKeyALSXSMFPNNAYPI-UHFFFAOYSA-N
XLogP0.31
TPSA69.89 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.10
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hydroxyiminobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxyiminobutanoic acid?
The IUPAC name of 2-hydroxyiminobutanoic acid (CID 6844451) is 2-hydroxyiminobutanoic acid.
What is the SMILES notation for 2-hydroxyiminobutanoic acid?
The canonical SMILES for 2-hydroxyiminobutanoic acid is CCC(=NO)C(=O)O.
What is the InChIKey of 2-hydroxyiminobutanoic acid?
The InChIKey is ALSXSMFPNNAYPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3/c1-2-3(5-8)4(6)7/h8H,2H2,1H3,(H,6,7).
What are the key properties of 2-hydroxyiminobutanoic acid?
2-hydroxyiminobutanoic acid has a molecular weight of 117.10 g/mol, XLogP of 0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyiminobutanoic acid is sourced from PubChem (CID 6844451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).