C20H18N4 — CID 684860
2,5-dimethyl-3,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 684860) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 2,5-dimethyl-3,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 684860 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2,5-dimethyl-3,6-diphenylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2c(-c3ccccc3)c(C)nn2c(N)c1-c1ccccc1 |
| InChI | InChI=1S/C20H18N4/c1-13-17(15-9-5-3-6-10-15)19(21)24-20(22-13)18(14(2)23-24)16-11-7-4-8-12-16/h3-12H,21H2,1-2H3 |
| InChIKey | COYLEYRJZHTLTR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |