About chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide)
chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) (PubChem CID 6849612) has the molecular formula C18H22CrN4O2+
and a molecular weight of 378.40 g/mol. Its IUPAC name is chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide).
Molecular Properties
| Compound Name | chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) |
| PubChem CID | 6849612 |
| Molecular Formula | C18H22CrN4O2+ |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) |
| SMILES | [Cr+3].[NH-]CCNC=C1C=CC=CC1=O.[NH-]CCNC=C1C=CC=CC1=O |
| InChI | InChI=1S/2C9H11N2O.Cr/c2*10-5-6-11-7-8-3-1-2-4-9(8)12;/h2*1-4,7,10-11H,5-6H2;/q2*-1;+3 |
| InChIKey | VQRYAQASLGAGPY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide)?
The IUPAC name of chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) (CID 6849612) is chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide).
What is the SMILES notation for chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide)?
The canonical SMILES for chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) is [Cr+3].[NH-]CCNC=C1C=CC=CC1=O.[NH-]CCNC=C1C=CC=CC1=O.
What is the InChIKey of chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide)?
The InChIKey is VQRYAQASLGAGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11N2O.Cr/c2*10-5-6-11-7-8-3-1-2-4-9(8)12;/h2*1-4,7,10-11H,5-6H2;/q2*-1;+3.
What are the key properties of chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide)?
chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) has a molecular weight of 378.40 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(3+);bis(2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylazanide) is sourced from PubChem (CID 6849612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).