C15H11N3OS3 — CID 684991
(5R)-3-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,6-dihydro-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 684991) has the molecular formula C15H11N3OS3 and a molecular weight of 345.47 g/mol. Its IUPAC name is (5R)-3-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,6-dihydro-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | (5R)-3-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,6-dihydro-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 684991 |
| Molecular Formula | C15H11N3OS3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | (5R)-3-phenyl-2-sulfanylidene-5-thiophen-2-yl-5,6-dihydro-4H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=C1N[C@H](c2cccs2)Nc2c1sc(=S)n2-c1ccccc1 |
| InChI | InChI=1S/C15H11N3OS3/c19-14-11-13(16-12(17-14)10-7-4-8-21-10)18(15(20)22-11)9-5-2-1-3-6-9/h1-8,12,16H,(H,17,19)/t12-/m1/s1 |
| InChIKey | RWOVYKGCCMDWEU-GFCCVEGCSA-N |
| XLogP | 4.18 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|