About bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+)
bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) (PubChem CID 6849986) has the molecular formula C20H28CoN4O2+3
and a molecular weight of 415.40 g/mol. Its IUPAC name is bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+).
Molecular Properties
| Compound Name | bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) |
| PubChem CID | 6849986 |
| Molecular Formula | C20H28CoN4O2+3 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) |
| SMILES | CC(N)CNC=C1C=CC=CC1=O.CC(N)CNC=C1C=CC=CC1=O.[Co+3] |
| InChI | InChI=1S/2C10H14N2O.Co/c2*1-8(11)6-12-7-9-4-2-3-5-10(9)13;/h2*2-5,7-8,12H,6,11H2,1H3;/q;;+3 |
| InChIKey | DXUYFJZUWXGYPH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+)?
The IUPAC name of bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) (CID 6849986) is bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+).
What is the SMILES notation for bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+)?
The canonical SMILES for bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) is CC(N)CNC=C1C=CC=CC1=O.CC(N)CNC=C1C=CC=CC1=O.[Co+3].
What is the InChIKey of bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+)?
The InChIKey is DXUYFJZUWXGYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14N2O.Co/c2*1-8(11)6-12-7-9-4-2-3-5-10(9)13;/h2*2-5,7-8,12H,6,11H2,1H3;/q;;+3.
What are the key properties of bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+)?
bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) has a molecular weight of 415.40 g/mol, XLogP of 1.00, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-[(2-aminopropylamino)methylidene]cyclohexa-2,4-dien-1-one);cobalt(3+) is sourced from PubChem (CID 6849986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).