C11H15ClN2O2 — CID 68500133
3-(1-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 68500133) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 3-(1-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(1-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 68500133 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-(1-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1C(C)Cl)CCCC2O |
| InChI | InChI=1S/C11H15ClN2O2/c1-6(12)9-7(2)13-10-8(15)4-3-5-14(10)11(9)16/h6,8,15H,3-5H2,1-2H3 |
| InChIKey | JHSKPRLZPNOUAN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|