C22H28F3N3O2 — CID 68500528
3-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]propanenitrile;2,2,2-trifluoroacetic acid (PubChem CID 68500528) has the molecular formula C22H28F3N3O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 3-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]propanenitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]propanenitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68500528 |
| Molecular Formula | C22H28F3N3O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-[4-[4-amino-3-(cyclohexen-1-yl)phenyl]piperidin-1-yl]propanenitrile;2,2,2-trifluoroacetic acid |
| SMILES | N#CCCN1CCC(c2ccc(N)c(C3=CCCCC3)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3.C2HF3O2/c21-11-4-12-23-13-9-16(10-14-23)18-7-8-20(22)19(15-18)17-5-2-1-3-6-17;3-2(4,5)1(6)7/h5,7-8,15-16H,1-4,6,9-10,12-14,22H2;(H,6,7) |
| InChIKey | JYLKLUGGHJZLOX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|