C17H18F2O6S2 — CID 68500570
2,2-difluoro-1,3-bis-(4-methylphenyl)sulfonylpropane-1,3-diol (PubChem CID 68500570) has the molecular formula C17H18F2O6S2 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2,2-difluoro-1,3-bis-(4-methylphenyl)sulfonylpropane-1,3-diol.
| Compound Name | 2,2-difluoro-1,3-bis-(4-methylphenyl)sulfonylpropane-1,3-diol |
|---|---|
| PubChem CID | 68500570 |
| Molecular Formula | C17H18F2O6S2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 2,2-difluoro-1,3-bis-(4-methylphenyl)sulfonylpropane-1,3-diol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)C(F)(F)C(O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H18F2O6S2/c1-11-3-7-13(8-4-11)26(22,23)15(20)17(18,19)16(21)27(24,25)14-9-5-12(2)6-10-14/h3-10,15-16,20-21H,1-2H3 |
| InChIKey | LIQUZVFQYZBURY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |