About 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one
3-hydroxy-1,3-dithiophen-2-ylpropan-1-one (PubChem CID 68500789) has the molecular formula C11H10O2S2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one |
| PubChem CID | 68500789 |
| Molecular Formula | C11H10O2S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one |
| SMILES | O=C(CC(O)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C11H10O2S2/c12-8(10-3-1-5-14-10)7-9(13)11-4-2-6-15-11/h1-6,8,12H,7H2 |
| InChIKey | UFXLCNNVYHKAJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one?
The IUPAC name of 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one (CID 68500789) is 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one.
What is the SMILES notation for 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one?
The canonical SMILES for 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one is O=C(CC(O)c1cccs1)c1cccs1.
What is the InChIKey of 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one?
The InChIKey is UFXLCNNVYHKAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2S2/c12-8(10-3-1-5-14-10)7-9(13)11-4-2-6-15-11/h1-6,8,12H,7H2.
What are the key properties of 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one?
3-hydroxy-1,3-dithiophen-2-ylpropan-1-one has a molecular weight of 238.33 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,3-dithiophen-2-ylpropan-1-one is sourced from PubChem (CID 68500789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).