C15H19F3N2O3 — CID 68500946
2-(4-methylpiperidin-1-yl)benzamide;2,2,2-trifluoroacetic acid (PubChem CID 68500946) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(4-methylpiperidin-1-yl)benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68500946 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCN(c2ccccc2C(N)=O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18N2O.C2HF3O2/c1-10-6-8-15(9-7-10)12-5-3-2-4-11(12)13(14)16;3-2(4,5)1(6)7/h2-5,10H,6-9H2,1H3,(H2,14,16);(H,6,7) |
| InChIKey | LTOSEBHDHIAQRK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |