C7H5F2NO4 — CID 68501113
[6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl] hydrogen carbonate (PubChem CID 68501113) has the molecular formula C7H5F2NO4 and a molecular weight of 205.12 g/mol. Its IUPAC name is [6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl] hydrogen carbonate.
| Compound Name | [6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68501113 |
| Molecular Formula | C7H5F2NO4 |
| Molecular Weight | 205.12 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | [6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc(C(F)F)[nH]c1=O |
| InChI | InChI=1S/C7H5F2NO4/c8-5(9)3-1-2-4(6(11)10-3)14-7(12)13/h1-2,5H,(H,10,11)(H,12,13) |
| InChIKey | FFJUVTYOCRRFLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |