C22H28F3N5O3S — CID 68501309
5-[3-(cyclohexylamino)propylcarbamoylamino]-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazole-4-carboxamide (PubChem CID 68501309) has the molecular formula C22H28F3N5O3S and a molecular weight of 499.56 g/mol. Its IUPAC name is 5-[3-(cyclohexylamino)propylcarbamoylamino]-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazole-4-carboxamide.
| Compound Name | 5-[3-(cyclohexylamino)propylcarbamoylamino]-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 68501309 |
| Molecular Formula | C22H28F3N5O3S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 5-[3-(cyclohexylamino)propylcarbamoylamino]-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazole-4-carboxamide |
| SMILES | CC(Oc1nsc(NC(=O)NCCCNC2CCCCC2)c1C(N)=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C22H28F3N5O3S/c1-12(16-14(23)8-9-15(24)18(16)25)33-20-17(19(26)31)21(34-30-20)29-22(32)28-11-5-10-27-13-6-3-2-4-7-13/h8-9,12-13,27H,2-7,10-11H2,1H3,(H2,26,31)(H2,28,29,32) |
| InChIKey | JLFFXGORQRGCBU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|