C32H51Cl2N2O3Zr+ — CID 6850197
oxidanium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;dichlorozirconium (PubChem CID 6850197) has the molecular formula C32H51Cl2N2O3Zr+ and a molecular weight of 673.90 g/mol. Its IUPAC name is oxidanium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;dichlorozirconium.
| Compound Name | oxidanium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;dichlorozirconium |
|---|---|
| PubChem CID | 6850197 |
| Molecular Formula | C32H51Cl2N2O3Zr+ |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | oxidanium;2,4-ditert-butyl-6-[[2-[(3,5-ditert-butyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;dichlorozirconium |
| SMILES | CC(C)(C)C1=CC(=CNCCNC=C2C=C(C(C)(C)C)C=C(C(C)(C)C)C2=O)C(=O)C(C(C)(C)C)=C1.Cl[Zr]Cl.[OH3+] |
| InChI | InChI=1S/C32H48N2O2.2ClH.H2O.Zr/c1-29(2,3)23-15-21(27(35)25(17-23)31(7,8)9)19-33-13-14-34-20-22-16-24(30(4,5)6)18-26(28(22)36)32(10,11)12;;;;/h15-20,33-34H,13-14H2,1-12H3;2*1H;1H2;/q;;;;+2/p-1 |
| InChIKey | DDEXHBUNPNDIOY-UHFFFAOYSA-M |
| XLogP | 7.44 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|