C15H20N2O — CID 685020
4-(3,3-dimethyl-4H-isoquinolin-1-yl)morpholine (PubChem CID 685020) has the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(3,3-dimethyl-4H-isoquinolin-1-yl)morpholine.
| Compound Name | 4-(3,3-dimethyl-4H-isoquinolin-1-yl)morpholine |
|---|---|
| PubChem CID | 685020 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-(3,3-dimethyl-4H-isoquinolin-1-yl)morpholine |
| SMILES | CC1(CC2=CC=CC=C2C(=N1)N3CCOCC3)C |
| InChI | InChI=1S/C15H20N2O/c1-15(2)11-12-5-3-4-6-13(12)14(16-15)17-7-9-18-10-8-17/h3-6H,7-11H2,1-2H3 |
| InChIKey | DBJSVWGTIHHPPU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 24.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 331 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |