About 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid
2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid (PubChem CID 68502179) has the molecular formula C12H8F2N2O3S
and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid |
| PubChem CID | 68502179 |
| Molecular Formula | C12H8F2N2O3S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid |
| SMILES | NC(=O)Nc1sc(-c2cc(F)cc(F)c2)cc1C(=O)O |
| InChI | InChI=1S/C12H8F2N2O3S/c13-6-1-5(2-7(14)3-6)9-4-8(11(17)18)10(20-9)16-12(15)19/h1-4H,(H,17,18)(H3,15,16,19) |
| InChIKey | BRHILXAMEQFOAI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The IUPAC name of 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid (CID 68502179) is 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The canonical SMILES for 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid is NC(=O)Nc1sc(-c2cc(F)cc(F)c2)cc1C(=O)O.
What is the InChIKey of 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
The InChIKey is BRHILXAMEQFOAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2O3S/c13-6-1-5(2-7(14)3-6)9-4-8(11(17)18)10(20-9)16-12(15)19/h1-4H,(H,17,18)(H3,15,16,19).
What are the key properties of 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid?
2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid has a molecular weight of 298.27 g/mol, XLogP of 2.88, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)-5-(3,5-difluorophenyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 68502179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).