About 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride
1-(aminomethyl)cyclohexan-1-ol;hydron;chloride (PubChem CID 68502238) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride.
Molecular Properties
| Compound Name | 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride |
| PubChem CID | 68502238 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride |
| SMILES | NCC1(O)CCCCC1.[Cl-].[H+] |
| InChI | InChI=1S/C7H15NO.ClH/c8-6-7(9)4-2-1-3-5-7;/h9H,1-6,8H2;1H |
| InChIKey | DXIAEURKHWGAFH-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride?
The IUPAC name of 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride (CID 68502238) is 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride.
What is the SMILES notation for 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride?
The canonical SMILES for 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride is NCC1(O)CCCCC1.[Cl-].[H+].
What is the InChIKey of 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride?
The InChIKey is DXIAEURKHWGAFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c8-6-7(9)4-2-1-3-5-7;/h9H,1-6,8H2;1H.
What are the key properties of 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride?
1-(aminomethyl)cyclohexan-1-ol;hydron;chloride has a molecular weight of 165.66 g/mol, XLogP of -2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride is sourced from PubChem (CID 68502238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).