C34H68O7Si3 — CID 68503107
[3,4,5-tris[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]methanol (PubChem CID 68503107) has the molecular formula C34H68O7Si3 and a molecular weight of 673.17 g/mol. Its IUPAC name is [3,4,5-tris[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]methanol.
| Compound Name | [3,4,5-tris[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]methanol |
|---|---|
| PubChem CID | 68503107 |
| Molecular Formula | C34H68O7Si3 |
| Molecular Weight | 673.17 g/mol |
| Exact Mass | 672.43 |
| IUPAC Name | [3,4,5-tris[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCOc1cc(CO)cc(OCCCO[Si](C)(C)C(C)(C)C)c1OCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H68O7Si3/c1-32(2,3)42(10,11)39-22-16-19-36-29-25-28(27-35)26-30(37-20-17-23-40-43(12,13)33(4,5)6)31(29)38-21-18-24-41-44(14,15)34(7,8)9/h25-26,35H,16-24,27H2,1-15H3 |
| InChIKey | FFGZJCZRHSQROB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.17 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|