C17H20MoN2O4 — CID 6850315
methanol;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxomolybdenum (PubChem CID 6850315) has the molecular formula C17H20MoN2O4 and a molecular weight of 412.30 g/mol. Its IUPAC name is methanol;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxomolybdenum.
| Compound Name | methanol;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxomolybdenum |
|---|---|
| PubChem CID | 6850315 |
| Molecular Formula | C17H20MoN2O4 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | methanol;6-[[2-[(6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one;oxomolybdenum |
| SMILES | CO.O=C1C=CC=CC1=CNCCNC=C1C=CC=CC1=O.O=[Mo] |
| InChI | InChI=1S/C16H16N2O2.CH4O.Mo.O/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;1-2;;/h1-8,11-12,17-18H,9-10H2;2H,1H3;; |
| InChIKey | KQHYGKUUGWTAPM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|