About N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide
N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide (PubChem CID 68503264) has the molecular formula C19H17N5
and a molecular weight of 315.38 g/mol. Its IUPAC name is N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide |
| PubChem CID | 68503264 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide |
| SMILES | Nc1ccccc1/N=N/C(=NNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N5/c20-17-13-7-8-14-18(17)22-24-19(15-9-3-1-4-10-15)23-21-16-11-5-2-6-12-16/h1-14,21H,20H2/b23-19?,24-22+ |
| InChIKey | AYPYBLYDLHQDSA-KSQZLRTGSA-N |
| XLogP | 4.83 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide?
The IUPAC name of N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide (CID 68503264) is N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide.
What is the SMILES notation for N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide?
The canonical SMILES for N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide is Nc1ccccc1/N=N/C(=NNc1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide?
The InChIKey is AYPYBLYDLHQDSA-KSQZLRTGSA-N. The full InChI is InChI=1S/C19H17N5/c20-17-13-7-8-14-18(17)22-24-19(15-9-3-1-4-10-15)23-21-16-11-5-2-6-12-16/h1-14,21H,20H2/b23-19?,24-22+.
What are the key properties of N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide?
N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide has a molecular weight of 315.38 g/mol, XLogP of 4.83, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)imino-N'-anilinobenzenecarboximidamide is sourced from PubChem (CID 68503264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).