About methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate
methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate (PubChem CID 68503801) has the molecular formula C11H16N2O4
and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
| PubChem CID | 68503801 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](c2cc(=O)[nH]o2)C[C@@H]1C |
| InChI | InChI=1S/C11H16N2O4/c1-7-5-8(9-6-10(14)12-17-9)3-4-13(7)11(15)16-2/h6-8H,3-5H2,1-2H3,(H,12,14)/t7-,8+/m0/s1 |
| InChIKey | ZPTNRFJTFMATFW-JGVFFNPUSA-N |
| XLogP | 1.30 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate?
The IUPAC name of methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate (CID 68503801) is methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate.
What is the SMILES notation for methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate?
The canonical SMILES for methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate is COC(=O)N1CC[C@@H](c2cc(=O)[nH]o2)C[C@@H]1C.
What is the InChIKey of methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate?
The InChIKey is ZPTNRFJTFMATFW-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H16N2O4/c1-7-5-8(9-6-10(14)12-17-9)3-4-13(7)11(15)16-2/h6-8H,3-5H2,1-2H3,(H,12,14)/t7-,8+/m0/s1.
What are the key properties of methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate?
methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate has a molecular weight of 240.26 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,4R)-2-methyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate is sourced from PubChem (CID 68503801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).