C10H14N4 — CID 68504611
2,3,3a,4-tetrahydro-1H-indazole;1H-pyrazole (PubChem CID 68504611) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-indazole;1H-pyrazole.
| Compound Name | 2,3,3a,4-tetrahydro-1H-indazole;1H-pyrazole |
|---|---|
| PubChem CID | 68504611 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-indazole;1H-pyrazole |
| SMILES | C1=CCC2CNNC2=C1.c1cn[nH]c1 |
| InChI | InChI=1S/C7H10N2.C3H4N2/c1-2-4-7-6(3-1)5-8-9-7;1-2-4-5-3-1/h1-2,4,6,8-9H,3,5H2;1-3H,(H,4,5) |
| InChIKey | VDKJLFPGSXBFRZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |