C22H25FN4O3 — CID 68505114
2-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-4-one (PubChem CID 68505114) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-4-one.
| Compound Name | 2-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 68505114 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[5-[(4,5-dimethyl-6-oxo-1H-pyridazin-3-yl)methyl]-2-fluorobenzoyl]-3,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-4-one |
| SMILES | Cc1c(Cc2ccc(F)c(C(=O)N3CC(=O)N4CCCCC4C3)c2)n[nH]c(=O)c1C |
| InChI | InChI=1S/C22H25FN4O3/c1-13-14(2)21(29)25-24-19(13)10-15-6-7-18(23)17(9-15)22(30)26-11-16-5-3-4-8-27(16)20(28)12-26/h6-7,9,16H,3-5,8,10-12H2,1-2H3,(H,25,29) |
| InChIKey | VJTRXXZCGWHXKE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |