About 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine
7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine (PubChem CID 68506381) has the molecular formula C7H4F3N3O
and a molecular weight of 203.12 g/mol. Its IUPAC name is 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine |
| PubChem CID | 68506381 |
| Molecular Formula | C7H4F3N3O |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine |
| SMILES | Nc1noc2c(C(F)(F)F)nccc12 |
| InChI | InChI=1S/C7H4F3N3O/c8-7(9,10)5-4-3(1-2-12-5)6(11)13-14-4/h1-2H,(H2,11,13) |
| InChIKey | ANPVSEZLFYKTQR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The IUPAC name of 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine (CID 68506381) is 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine.
What is the SMILES notation for 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The canonical SMILES for 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine is Nc1noc2c(C(F)(F)F)nccc12.
What is the InChIKey of 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine?
The InChIKey is ANPVSEZLFYKTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F3N3O/c8-7(9,10)5-4-3(1-2-12-5)6(11)13-14-4/h1-2H,(H2,11,13).
What are the key properties of 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine?
7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine has a molecular weight of 203.12 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-[1,2]oxazolo[5,4-c]pyridin-3-amine is sourced from PubChem (CID 68506381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).