About 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol
2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol (PubChem CID 68506394) has the molecular formula C17H17BrClNO
and a molecular weight of 366.69 g/mol. Its IUPAC name is 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol |
| PubChem CID | 68506394 |
| Molecular Formula | C17H17BrClNO |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol |
| SMILES | CN1CC[C@@H](c2cc(Cl)ccc2Br)[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C17H17BrClNO/c1-20-9-8-12(14-10-11(19)6-7-15(14)18)17(20)13-4-2-3-5-16(13)21/h2-7,10,12,17,21H,8-9H2,1H3/t12-,17+/m0/s1 |
| InChIKey | YVXOUVFHIWZZNI-YVEFUNNKSA-N |
| XLogP | 4.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol?
The IUPAC name of 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol (CID 68506394) is 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol.
What is the SMILES notation for 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol?
The canonical SMILES for 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol is CN1CC[C@@H](c2cc(Cl)ccc2Br)[C@@H]1c1ccccc1O.
What is the InChIKey of 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol?
The InChIKey is YVXOUVFHIWZZNI-YVEFUNNKSA-N. The full InChI is InChI=1S/C17H17BrClNO/c1-20-9-8-12(14-10-11(19)6-7-15(14)18)17(20)13-4-2-3-5-16(13)21/h2-7,10,12,17,21H,8-9H2,1H3/t12-,17+/m0/s1.
What are the key properties of 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol?
2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol has a molecular weight of 366.69 g/mol, XLogP of 4.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3S)-3-(2-bromo-5-chlorophenyl)-1-methylpyrrolidin-2-yl]phenol is sourced from PubChem (CID 68506394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).