C17H18N4O2S — CID 68506478
3-amino-4-(4,5-dimethylfuran-2-yl)-6-(3-hydroxypropylamino)thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 68506478) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-amino-4-(4,5-dimethylfuran-2-yl)-6-(3-hydroxypropylamino)thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 3-amino-4-(4,5-dimethylfuran-2-yl)-6-(3-hydroxypropylamino)thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 68506478 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-amino-4-(4,5-dimethylfuran-2-yl)-6-(3-hydroxypropylamino)thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | Cc1cc(-c2c(C#N)c(NCCCO)nc3scc(N)c23)oc1C |
| InChI | InChI=1S/C17H18N4O2S/c1-9-6-13(23-10(9)2)14-11(7-18)16(20-4-3-5-22)21-17-15(14)12(19)8-24-17/h6,8,22H,3-5,19H2,1-2H3,(H,20,21) |
| InChIKey | SIKOXDHTROESKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|