About 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid
2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (PubChem CID 68506592) has the molecular formula C20H18FN3O3
and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| PubChem CID | 68506592 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CN(C(=O)Nc1ccccc1F)CC2 |
| InChI | InChI=1S/C20H18FN3O3/c21-15-6-2-3-7-16(15)22-20(27)23-10-9-18-14(11-23)13-5-1-4-8-17(13)24(18)12-19(25)26/h1-8H,9-12H2,(H,22,27)(H,25,26) |
| InChIKey | XUJNJRBSGBCBAZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The IUPAC name of 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (CID 68506592) is 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The canonical SMILES for 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is O=C(O)Cn1c2c(c3ccccc31)CN(C(=O)Nc1ccccc1F)CC2.
What is the InChIKey of 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The InChIKey is XUJNJRBSGBCBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O3/c21-15-6-2-3-7-16(15)22-20(27)23-10-9-18-14(11-23)13-5-1-4-8-17(13)24(18)12-19(25)26/h1-8H,9-12H2,(H,22,27)(H,25,26).
What are the key properties of 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid has a molecular weight of 367.38 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2-fluorophenyl)carbamoyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is sourced from PubChem (CID 68506592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).